About 1-(2,5-dichlorophenyl)-2-methyl-6,7-dihydro-5H-indol-4-one
1-(2,5-dichlorophenyl)-2-methyl-6,7-dihydro-5H-indol-4-one (PubChem CID 60723538) has the molecular formula C15H13Cl2NO
and a molecular weight of 294.18 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-2-methyl-6,7-dihydro-5H-indol-4-one.
Molecular Properties
| Compound Name | 1-(2,5-dichlorophenyl)-2-methyl-6,7-dihydro-5H-indol-4-one |
| PubChem CID | 60723538 |
| Molecular Formula | C15H13Cl2NO |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-2-methyl-6,7-dihydro-5H-indol-4-one |
| SMILES | Cc1cc2c(n1-c1cc(Cl)ccc1Cl)CCCC2=O |
| InChI | InChI=1S/C15H13Cl2NO/c1-9-7-11-13(3-2-4-15(11)19)18(9)14-8-10(16)5-6-12(14)17/h5-8H,2-4H2,1H3 |
| InChIKey | XYKYZPRVNJYKCR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,5-dichlorophenyl)-2-methyl-6,7-dihydro-5H-indol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dichlorophenyl)-2-methyl-6,7-dihydro-5H-indol-4-one?
The IUPAC name of 1-(2,5-dichlorophenyl)-2-methyl-6,7-dihydro-5H-indol-4-one (CID 60723538) is 1-(2,5-dichlorophenyl)-2-methyl-6,7-dihydro-5H-indol-4-one.
What is the SMILES notation for 1-(2,5-dichlorophenyl)-2-methyl-6,7-dihydro-5H-indol-4-one?
The canonical SMILES for 1-(2,5-dichlorophenyl)-2-methyl-6,7-dihydro-5H-indol-4-one is Cc1cc2c(n1-c1cc(Cl)ccc1Cl)CCCC2=O.
What is the InChIKey of 1-(2,5-dichlorophenyl)-2-methyl-6,7-dihydro-5H-indol-4-one?
The InChIKey is XYKYZPRVNJYKCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Cl2NO/c1-9-7-11-13(3-2-4-15(11)19)18(9)14-8-10(16)5-6-12(14)17/h5-8H,2-4H2,1H3.
What are the key properties of 1-(2,5-dichlorophenyl)-2-methyl-6,7-dihydro-5H-indol-4-one?
1-(2,5-dichlorophenyl)-2-methyl-6,7-dihydro-5H-indol-4-one has a molecular weight of 294.18 g/mol, XLogP of 4.61, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dichlorophenyl)-2-methyl-6,7-dihydro-5H-indol-4-one is sourced from PubChem (CID 60723538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).