C14H11ClFN3O2 — CID 60723641
N-(3-acetamido-4-fluorophenyl)-6-chloropyridine-3-carboxamide (PubChem CID 60723641) has the molecular formula C14H11ClFN3O2 and a molecular weight of 307.71 g/mol. Its IUPAC name is N-(3-acetamido-4-fluorophenyl)-6-chloropyridine-3-carboxamide.
| Compound Name | N-(3-acetamido-4-fluorophenyl)-6-chloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 60723641 |
| Molecular Formula | C14H11ClFN3O2 |
| Molecular Weight | 307.71 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | N-(3-acetamido-4-fluorophenyl)-6-chloropyridine-3-carboxamide |
| SMILES | CC(=O)Nc1cc(NC(=O)c2ccc(Cl)nc2)ccc1F |
| InChI | InChI=1S/C14H11ClFN3O2/c1-8(20)18-12-6-10(3-4-11(12)16)19-14(21)9-2-5-13(15)17-7-9/h2-7H,1H3,(H,18,20)(H,19,21) |
| InChIKey | YZNUOLYITYNVNG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.71 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|