About 4-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-2-oxo-3H-1,3-thiazole-5-sulfonamide
4-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-2-oxo-3H-1,3-thiazole-5-sulfonamide (PubChem CID 60724014) has the molecular formula C9H14N2O5S3
and a molecular weight of 326.42 g/mol. Its IUPAC name is 4-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-2-oxo-3H-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | 4-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-2-oxo-3H-1,3-thiazole-5-sulfonamide |
| PubChem CID | 60724014 |
| Molecular Formula | C9H14N2O5S3 |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 4-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-2-oxo-3H-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1[nH]c(=O)sc1S(=O)(=O)NC1(C)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H14N2O5S3/c1-6-7(17-8(12)10-6)19(15,16)11-9(2)3-4-18(13,14)5-9/h11H,3-5H2,1-2H3,(H,10,12) |
| InChIKey | TYJMHHUWGZWCIE-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 113.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-2-oxo-3H-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-2-oxo-3H-1,3-thiazole-5-sulfonamide?
The IUPAC name of 4-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-2-oxo-3H-1,3-thiazole-5-sulfonamide (CID 60724014) is 4-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-2-oxo-3H-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for 4-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-2-oxo-3H-1,3-thiazole-5-sulfonamide?
The canonical SMILES for 4-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-2-oxo-3H-1,3-thiazole-5-sulfonamide is Cc1[nH]c(=O)sc1S(=O)(=O)NC1(C)CCS(=O)(=O)C1.
What is the InChIKey of 4-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-2-oxo-3H-1,3-thiazole-5-sulfonamide?
The InChIKey is TYJMHHUWGZWCIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O5S3/c1-6-7(17-8(12)10-6)19(15,16)11-9(2)3-4-18(13,14)5-9/h11H,3-5H2,1-2H3,(H,10,12).
What are the key properties of 4-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-2-oxo-3H-1,3-thiazole-5-sulfonamide?
4-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-2-oxo-3H-1,3-thiazole-5-sulfonamide has a molecular weight of 326.42 g/mol, XLogP of -0.40, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-(3-methyl-1,1-dioxothiolan-3-yl)-2-oxo-3H-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 60724014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).