C14H19N3O — CID 60724445
N-tert-butyl-2-(4-cyano-N-methylanilino)acetamide (PubChem CID 60724445) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is N-tert-butyl-2-(4-cyano-N-methylanilino)acetamide.
| Compound Name | N-tert-butyl-2-(4-cyano-N-methylanilino)acetamide |
|---|---|
| PubChem CID | 60724445 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | N-tert-butyl-2-(4-cyano-N-methylanilino)acetamide |
| SMILES | CN(CC(=O)NC(C)(C)C)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H19N3O/c1-14(2,3)16-13(18)10-17(4)12-7-5-11(9-15)6-8-12/h5-8H,10H2,1-4H3,(H,16,18) |
| InChIKey | VRDNZVYXQDZVFT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |