About N-(1-cyclopropylethyl)-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide
N-(1-cyclopropylethyl)-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide (PubChem CID 60724887) has the molecular formula C10H16N2O3S2
and a molecular weight of 276.38 g/mol. Its IUPAC name is N-(1-cyclopropylethyl)-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-(1-cyclopropylethyl)-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide |
| PubChem CID | 60724887 |
| Molecular Formula | C10H16N2O3S2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | N-(1-cyclopropylethyl)-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1[nH]c(=O)sc1S(=O)(=O)N(C)C(C)C1CC1 |
| InChI | InChI=1S/C10H16N2O3S2/c1-6-9(16-10(13)11-6)17(14,15)12(3)7(2)8-4-5-8/h7-8H,4-5H2,1-3H3,(H,11,13) |
| InChIKey | SSBCROCSZAUTGP-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1-cyclopropylethyl)-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyclopropylethyl)-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide?
The IUPAC name of N-(1-cyclopropylethyl)-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide (CID 60724887) is N-(1-cyclopropylethyl)-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for N-(1-cyclopropylethyl)-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide?
The canonical SMILES for N-(1-cyclopropylethyl)-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide is Cc1[nH]c(=O)sc1S(=O)(=O)N(C)C(C)C1CC1.
What is the InChIKey of N-(1-cyclopropylethyl)-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide?
The InChIKey is SSBCROCSZAUTGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O3S2/c1-6-9(16-10(13)11-6)17(14,15)12(3)7(2)8-4-5-8/h7-8H,4-5H2,1-3H3,(H,11,13).
What are the key properties of N-(1-cyclopropylethyl)-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide?
N-(1-cyclopropylethyl)-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide has a molecular weight of 276.38 g/mol, XLogP of 1.16, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyclopropylethyl)-N,4-dimethyl-2-oxo-3H-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 60724887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).