About (4E)-2-(2,3-dichlorophenyl)-4-[(5-methylfuran-2-yl)methylidene]-1,3-oxazol-5-one
(4E)-2-(2,3-dichlorophenyl)-4-[(5-methylfuran-2-yl)methylidene]-1,3-oxazol-5-one (PubChem CID 6072563) has the molecular formula C15H9Cl2NO3
and a molecular weight of 322.15 g/mol. Its IUPAC name is (4E)-2-(2,3-dichlorophenyl)-4-[(5-methylfuran-2-yl)methylidene]-1,3-oxazol-5-one.
Molecular Properties
| Compound Name | (4E)-2-(2,3-dichlorophenyl)-4-[(5-methylfuran-2-yl)methylidene]-1,3-oxazol-5-one |
| PubChem CID | 6072563 |
| Molecular Formula | C15H9Cl2NO3 |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | (4E)-2-(2,3-dichlorophenyl)-4-[(5-methylfuran-2-yl)methylidene]-1,3-oxazol-5-one |
| SMILES | Cc1ccc(/C=C2/N=C(c3cccc(Cl)c3Cl)OC2=O)o1 |
| InChI | InChI=1S/C15H9Cl2NO3/c1-8-5-6-9(20-8)7-12-15(19)21-14(18-12)10-3-2-4-11(16)13(10)17/h2-7H,1H3/b12-7+ |
| InChIKey | JBORAKUIWHKMFB-KPKJPENVSA-N |
| XLogP | 4.24 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4E)-2-(2,3-dichlorophenyl)-4-[(5-methylfuran-2-yl)methylidene]-1,3-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-2-(2,3-dichlorophenyl)-4-[(5-methylfuran-2-yl)methylidene]-1,3-oxazol-5-one?
The IUPAC name of (4E)-2-(2,3-dichlorophenyl)-4-[(5-methylfuran-2-yl)methylidene]-1,3-oxazol-5-one (CID 6072563) is (4E)-2-(2,3-dichlorophenyl)-4-[(5-methylfuran-2-yl)methylidene]-1,3-oxazol-5-one.
What is the SMILES notation for (4E)-2-(2,3-dichlorophenyl)-4-[(5-methylfuran-2-yl)methylidene]-1,3-oxazol-5-one?
The canonical SMILES for (4E)-2-(2,3-dichlorophenyl)-4-[(5-methylfuran-2-yl)methylidene]-1,3-oxazol-5-one is Cc1ccc(/C=C2/N=C(c3cccc(Cl)c3Cl)OC2=O)o1.
What is the InChIKey of (4E)-2-(2,3-dichlorophenyl)-4-[(5-methylfuran-2-yl)methylidene]-1,3-oxazol-5-one?
The InChIKey is JBORAKUIWHKMFB-KPKJPENVSA-N. The full InChI is InChI=1S/C15H9Cl2NO3/c1-8-5-6-9(20-8)7-12-15(19)21-14(18-12)10-3-2-4-11(16)13(10)17/h2-7H,1H3/b12-7+.
What are the key properties of (4E)-2-(2,3-dichlorophenyl)-4-[(5-methylfuran-2-yl)methylidene]-1,3-oxazol-5-one?
(4E)-2-(2,3-dichlorophenyl)-4-[(5-methylfuran-2-yl)methylidene]-1,3-oxazol-5-one has a molecular weight of 322.15 g/mol, XLogP of 4.24, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-2-(2,3-dichlorophenyl)-4-[(5-methylfuran-2-yl)methylidene]-1,3-oxazol-5-one is sourced from PubChem (CID 6072563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).