About (E)-1-methyl-N-(1H-1,2,4-triazol-5-yl)pyrrolidin-2-imine
(E)-1-methyl-N-(1H-1,2,4-triazol-5-yl)pyrrolidin-2-imine (PubChem CID 6072578) has the molecular formula C7H11N5
and a molecular weight of 165.20 g/mol. Its IUPAC name is (E)-1-methyl-N-(1H-1,2,4-triazol-5-yl)pyrrolidin-2-imine.
Molecular Properties
| Compound Name | (E)-1-methyl-N-(1H-1,2,4-triazol-5-yl)pyrrolidin-2-imine |
| PubChem CID | 6072578 |
| Molecular Formula | C7H11N5 |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | (E)-1-methyl-N-(1H-1,2,4-triazol-5-yl)pyrrolidin-2-imine |
| SMILES | CN1CCC/C1=N\c1ncn[nH]1 |
| InChI | InChI=1S/C7H11N5/c1-12-4-2-3-6(12)10-7-8-5-9-11-7/h5H,2-4H2,1H3,(H,8,9,11)/b10-6+ |
| InChIKey | AMVHBDMSJNWYDE-UXBLZVDNSA-N |
| XLogP | 0.56 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-methyl-N-(1H-1,2,4-triazol-5-yl)pyrrolidin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-methyl-N-(1H-1,2,4-triazol-5-yl)pyrrolidin-2-imine?
The IUPAC name of (E)-1-methyl-N-(1H-1,2,4-triazol-5-yl)pyrrolidin-2-imine (CID 6072578) is (E)-1-methyl-N-(1H-1,2,4-triazol-5-yl)pyrrolidin-2-imine.
What is the SMILES notation for (E)-1-methyl-N-(1H-1,2,4-triazol-5-yl)pyrrolidin-2-imine?
The canonical SMILES for (E)-1-methyl-N-(1H-1,2,4-triazol-5-yl)pyrrolidin-2-imine is CN1CCC/C1=N\c1ncn[nH]1.
What is the InChIKey of (E)-1-methyl-N-(1H-1,2,4-triazol-5-yl)pyrrolidin-2-imine?
The InChIKey is AMVHBDMSJNWYDE-UXBLZVDNSA-N. The full InChI is InChI=1S/C7H11N5/c1-12-4-2-3-6(12)10-7-8-5-9-11-7/h5H,2-4H2,1H3,(H,8,9,11)/b10-6+.
What are the key properties of (E)-1-methyl-N-(1H-1,2,4-triazol-5-yl)pyrrolidin-2-imine?
(E)-1-methyl-N-(1H-1,2,4-triazol-5-yl)pyrrolidin-2-imine has a molecular weight of 165.20 g/mol, XLogP of 0.56, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-methyl-N-(1H-1,2,4-triazol-5-yl)pyrrolidin-2-imine is sourced from PubChem (CID 6072578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).