C12H11ClN2O — CID 60726049
4-chloro-6-(2,4-dimethylphenoxy)pyrimidine (PubChem CID 60726049) has the molecular formula C12H11ClN2O and a molecular weight of 234.69 g/mol. Its IUPAC name is 4-chloro-6-(2,4-dimethylphenoxy)pyrimidine.
| Compound Name | 4-chloro-6-(2,4-dimethylphenoxy)pyrimidine |
|---|---|
| PubChem CID | 60726049 |
| Molecular Formula | C12H11ClN2O |
| Molecular Weight | 234.69 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 4-chloro-6-(2,4-dimethylphenoxy)pyrimidine |
| SMILES | Cc1ccc(Oc2cc(Cl)ncn2)c(C)c1 |
| InChI | InChI=1S/C12H11ClN2O/c1-8-3-4-10(9(2)5-8)16-12-6-11(13)14-7-15-12/h3-7H,1-2H3 |
| InChIKey | SHKXTPOZBQJHRO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.69 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |