C12H7ClN2O3S — CID 60727066
7-[(4-chloro-1,2,5-thiadiazol-3-yl)oxy]-4-methylchromen-2-one (PubChem CID 60727066) has the molecular formula C12H7ClN2O3S and a molecular weight of 294.72 g/mol. Its IUPAC name is 7-[(4-chloro-1,2,5-thiadiazol-3-yl)oxy]-4-methylchromen-2-one.
| Compound Name | 7-[(4-chloro-1,2,5-thiadiazol-3-yl)oxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 60727066 |
| Molecular Formula | C12H7ClN2O3S |
| Molecular Weight | 294.72 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | 7-[(4-chloro-1,2,5-thiadiazol-3-yl)oxy]-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(Oc3nsnc3Cl)ccc12 |
| InChI | InChI=1S/C12H7ClN2O3S/c1-6-4-10(16)18-9-5-7(2-3-8(6)9)17-12-11(13)14-19-15-12/h2-5H,1H3 |
| InChIKey | UXDMBBNLONIKBG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.72 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|