About 5-[(2,3-dihydro-1H-inden-1-ylamino)methyl]pyrrolidin-2-one
5-[(2,3-dihydro-1H-inden-1-ylamino)methyl]pyrrolidin-2-one (PubChem CID 60727404) has the molecular formula C14H18N2O
and a molecular weight of 230.31 g/mol. Its IUPAC name is 5-[(2,3-dihydro-1H-inden-1-ylamino)methyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 5-[(2,3-dihydro-1H-inden-1-ylamino)methyl]pyrrolidin-2-one |
| PubChem CID | 60727404 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 5-[(2,3-dihydro-1H-inden-1-ylamino)methyl]pyrrolidin-2-one |
| SMILES | O=C1CCC(CNC2CCc3ccccc32)N1 |
| InChI | InChI=1S/C14H18N2O/c17-14-8-6-11(16-14)9-15-13-7-5-10-3-1-2-4-12(10)13/h1-4,11,13,15H,5-9H2,(H,16,17) |
| InChIKey | SEKMZSMNUZOSQA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(2,3-dihydro-1H-inden-1-ylamino)methyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,3-dihydro-1H-inden-1-ylamino)methyl]pyrrolidin-2-one?
The IUPAC name of 5-[(2,3-dihydro-1H-inden-1-ylamino)methyl]pyrrolidin-2-one (CID 60727404) is 5-[(2,3-dihydro-1H-inden-1-ylamino)methyl]pyrrolidin-2-one.
What is the SMILES notation for 5-[(2,3-dihydro-1H-inden-1-ylamino)methyl]pyrrolidin-2-one?
The canonical SMILES for 5-[(2,3-dihydro-1H-inden-1-ylamino)methyl]pyrrolidin-2-one is O=C1CCC(CNC2CCc3ccccc32)N1.
What is the InChIKey of 5-[(2,3-dihydro-1H-inden-1-ylamino)methyl]pyrrolidin-2-one?
The InChIKey is SEKMZSMNUZOSQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O/c17-14-8-6-11(16-14)9-15-13-7-5-10-3-1-2-4-12(10)13/h1-4,11,13,15H,5-9H2,(H,16,17).
What are the key properties of 5-[(2,3-dihydro-1H-inden-1-ylamino)methyl]pyrrolidin-2-one?
5-[(2,3-dihydro-1H-inden-1-ylamino)methyl]pyrrolidin-2-one has a molecular weight of 230.31 g/mol, XLogP of 1.54, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,3-dihydro-1H-inden-1-ylamino)methyl]pyrrolidin-2-one is sourced from PubChem (CID 60727404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).