1-cyclopropyl-2,4-dimethyl-6-oxopyridine-3-carboxylic acid

C11H13NO3 — CID 60727884

IUPAC1-cyclopropyl-2,4-dimethyl-6-oxopyridine-3-carboxylic acid
SMILESCc1cc(=O)n(C2CC2)c(C)c1C(=O)O
InChIInChI=1S/C11H13NO3/c1-6-5-9(13)12(8-3-4-8)7(2)10(6)11(14)15/h5,8H,3-4H2,1-2H3,(H,14,15)
InChIKeyUUNSWCXBTFCIJN-UHFFFAOYSA-N
MW207.23 g/mol
LogP1.50
Rot. Bonds2

About 1-cyclopropyl-2,4-dimethyl-6-oxopyridine-3-carboxylic acid

1-cyclopropyl-2,4-dimethyl-6-oxopyridine-3-carboxylic acid (PubChem CID 60727884) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 1-cyclopropyl-2,4-dimethyl-6-oxopyridine-3-carboxylic acid.

Molecular Properties

Compound Name1-cyclopropyl-2,4-dimethyl-6-oxopyridine-3-carboxylic acid
PubChem CID60727884
Molecular FormulaC11H13NO3
Molecular Weight207.23 g/mol
Exact Mass207.09
IUPAC Name1-cyclopropyl-2,4-dimethyl-6-oxopyridine-3-carboxylic acid
SMILESCc1cc(=O)n(C2CC2)c(C)c1C(=O)O
InChIInChI=1S/C11H13NO3/c1-6-5-9(13)12(8-3-4-8)7(2)10(6)11(14)15/h5,8H,3-4H2,1-2H3,(H,14,15)
InChIKeyUUNSWCXBTFCIJN-UHFFFAOYSA-N
XLogP1.50
TPSA59.30 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.23
LogP ≤ 51.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1-cyclopropyl-2,4-dimethyl-6-oxopyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-cyclopropyl-2,4-dimethyl-6-oxopyridine-3-carboxylic acid?
The IUPAC name of 1-cyclopropyl-2,4-dimethyl-6-oxopyridine-3-carboxylic acid (CID 60727884) is 1-cyclopropyl-2,4-dimethyl-6-oxopyridine-3-carboxylic acid.
What is the SMILES notation for 1-cyclopropyl-2,4-dimethyl-6-oxopyridine-3-carboxylic acid?
The canonical SMILES for 1-cyclopropyl-2,4-dimethyl-6-oxopyridine-3-carboxylic acid is Cc1cc(=O)n(C2CC2)c(C)c1C(=O)O.
What is the InChIKey of 1-cyclopropyl-2,4-dimethyl-6-oxopyridine-3-carboxylic acid?
The InChIKey is UUNSWCXBTFCIJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3/c1-6-5-9(13)12(8-3-4-8)7(2)10(6)11(14)15/h5,8H,3-4H2,1-2H3,(H,14,15).
What are the key properties of 1-cyclopropyl-2,4-dimethyl-6-oxopyridine-3-carboxylic acid?
1-cyclopropyl-2,4-dimethyl-6-oxopyridine-3-carboxylic acid has a molecular weight of 207.23 g/mol, XLogP of 1.50, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-2,4-dimethyl-6-oxopyridine-3-carboxylic acid is sourced from PubChem (CID 60727884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).