C10H9BrCl2F3NO3S — CID 60728882
4-bromo-2,6-dichloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzenesulfonamide (PubChem CID 60728882) has the molecular formula C10H9BrCl2F3NO3S and a molecular weight of 431.06 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzenesulfonamide.
| Compound Name | 4-bromo-2,6-dichloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 60728882 |
| Molecular Formula | C10H9BrCl2F3NO3S |
| Molecular Weight | 431.06 g/mol |
| Exact Mass | 428.88 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCOCC(F)(F)F)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C10H9BrCl2F3NO3S/c11-6-3-7(12)9(8(13)4-6)21(18,19)17-1-2-20-5-10(14,15)16/h3-4,17H,1-2,5H2 |
| InChIKey | JDSPCOIYGBODHT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.06 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|