About [(Z)-(1,1-dioxothiolan-3-ylidene)amino]urea
[(Z)-(1,1-dioxothiolan-3-ylidene)amino]urea (PubChem CID 60728931) has the molecular formula C5H9N3O3S
and a molecular weight of 191.21 g/mol. Its IUPAC name is [(Z)-(1,1-dioxothiolan-3-ylidene)amino]urea.
Molecular Properties
| Compound Name | [(Z)-(1,1-dioxothiolan-3-ylidene)amino]urea |
| PubChem CID | 60728931 |
| Molecular Formula | C5H9N3O3S |
| Molecular Weight | 191.21 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | [(Z)-(1,1-dioxothiolan-3-ylidene)amino]urea |
| SMILES | NC(=O)N/N=C1/CCS(=O)(=O)C1 |
| InChI | InChI=1S/C5H9N3O3S/c6-5(9)8-7-4-1-2-12(10,11)3-4/h1-3H2,(H3,6,8,9)/b7-4- |
| InChIKey | BPHNJEVFSYQPOQ-DAXSKMNVSA-N |
| XLogP | -1.17 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.21 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-(1,1-dioxothiolan-3-ylidene)amino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-(1,1-dioxothiolan-3-ylidene)amino]urea?
The IUPAC name of [(Z)-(1,1-dioxothiolan-3-ylidene)amino]urea (CID 60728931) is [(Z)-(1,1-dioxothiolan-3-ylidene)amino]urea.
What is the SMILES notation for [(Z)-(1,1-dioxothiolan-3-ylidene)amino]urea?
The canonical SMILES for [(Z)-(1,1-dioxothiolan-3-ylidene)amino]urea is NC(=O)N/N=C1/CCS(=O)(=O)C1.
What is the InChIKey of [(Z)-(1,1-dioxothiolan-3-ylidene)amino]urea?
The InChIKey is BPHNJEVFSYQPOQ-DAXSKMNVSA-N. The full InChI is InChI=1S/C5H9N3O3S/c6-5(9)8-7-4-1-2-12(10,11)3-4/h1-3H2,(H3,6,8,9)/b7-4-.
What are the key properties of [(Z)-(1,1-dioxothiolan-3-ylidene)amino]urea?
[(Z)-(1,1-dioxothiolan-3-ylidene)amino]urea has a molecular weight of 191.21 g/mol, XLogP of -1.17, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-(1,1-dioxothiolan-3-ylidene)amino]urea is sourced from PubChem (CID 60728931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).