C13H26F3NO3 — CID 60729629
1-(4-methylpentan-2-yloxy)-3-[2-(2,2,2-trifluoroethoxy)ethylamino]propan-2-ol (PubChem CID 60729629) has the molecular formula C13H26F3NO3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 1-(4-methylpentan-2-yloxy)-3-[2-(2,2,2-trifluoroethoxy)ethylamino]propan-2-ol.
| Compound Name | 1-(4-methylpentan-2-yloxy)-3-[2-(2,2,2-trifluoroethoxy)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 60729629 |
| Molecular Formula | C13H26F3NO3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 1-(4-methylpentan-2-yloxy)-3-[2-(2,2,2-trifluoroethoxy)ethylamino]propan-2-ol |
| SMILES | CC(C)CC(C)OCC(O)CNCCOCC(F)(F)F |
| InChI | InChI=1S/C13H26F3NO3/c1-10(2)6-11(3)20-8-12(18)7-17-4-5-19-9-13(14,15)16/h10-12,17-18H,4-9H2,1-3H3 |
| InChIKey | YACUHPKGXSQIHX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|