C9H17N3OS — CID 60730410
2-[methyl-(2-oxo-2-pyrrolidin-1-ylethyl)amino]ethanethioamide (PubChem CID 60730410) has the molecular formula C9H17N3OS and a molecular weight of 215.32 g/mol. Its IUPAC name is 2-[methyl-(2-oxo-2-pyrrolidin-1-ylethyl)amino]ethanethioamide.
| Compound Name | 2-[methyl-(2-oxo-2-pyrrolidin-1-ylethyl)amino]ethanethioamide |
|---|---|
| PubChem CID | 60730410 |
| Molecular Formula | C9H17N3OS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 2-[methyl-(2-oxo-2-pyrrolidin-1-ylethyl)amino]ethanethioamide |
| SMILES | CN(CC(=O)N1CCCC1)CC(N)=S |
| InChI | InChI=1S/C9H17N3OS/c1-11(6-8(10)14)7-9(13)12-4-2-3-5-12/h2-7H2,1H3,(H2,10,14) |
| InChIKey | SADZMCFUIFNLGN-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|