C10H11F3N2O3 — CID 60730454
6-oxo-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyridine-3-carboxamide (PubChem CID 60730454) has the molecular formula C10H11F3N2O3 and a molecular weight of 264.20 g/mol. Its IUPAC name is 6-oxo-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyridine-3-carboxamide.
| Compound Name | 6-oxo-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 60730454 |
| Molecular Formula | C10H11F3N2O3 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 6-oxo-N-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyridine-3-carboxamide |
| SMILES | O=C(NCCOCC(F)(F)F)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C10H11F3N2O3/c11-10(12,13)6-18-4-3-14-9(17)7-1-2-8(16)15-5-7/h1-2,5H,3-4,6H2,(H,14,17)(H,15,16) |
| InChIKey | XBPSDNBWXJQSNZ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|