6-(3-methoxy-3-oxopropyl)sulfanylpyridine-2-carboxylic acid

C10H11NO4S — CID 60730616

IUPAC6-(3-methoxy-3-oxopropyl)sulfanylpyridine-2-carboxylic acid
SMILESCOC(=O)CCSc1cccc(C(=O)O)n1
InChIInChI=1S/C10H11NO4S/c1-15-9(12)5-6-16-8-4-2-3-7(11-8)10(13)14/h2-4H,5-6H2,1H3,(H,13,14)
InChIKeyZWCINQPEGSIOQO-UHFFFAOYSA-N
MW241.27 g/mol
LogP1.43
Rot. Bonds5

About 6-(3-methoxy-3-oxopropyl)sulfanylpyridine-2-carboxylic acid

6-(3-methoxy-3-oxopropyl)sulfanylpyridine-2-carboxylic acid (PubChem CID 60730616) has the molecular formula C10H11NO4S and a molecular weight of 241.27 g/mol. Its IUPAC name is 6-(3-methoxy-3-oxopropyl)sulfanylpyridine-2-carboxylic acid.

Molecular Properties

Compound Name6-(3-methoxy-3-oxopropyl)sulfanylpyridine-2-carboxylic acid
PubChem CID60730616
Molecular FormulaC10H11NO4S
Molecular Weight241.27 g/mol
Exact Mass241.04
IUPAC Name6-(3-methoxy-3-oxopropyl)sulfanylpyridine-2-carboxylic acid
SMILESCOC(=O)CCSc1cccc(C(=O)O)n1
InChIInChI=1S/C10H11NO4S/c1-15-9(12)5-6-16-8-4-2-3-7(11-8)10(13)14/h2-4H,5-6H2,1H3,(H,13,14)
InChIKeyZWCINQPEGSIOQO-UHFFFAOYSA-N
XLogP1.43
TPSA76.49 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.27
LogP ≤ 51.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 6-(3-methoxy-3-oxopropyl)sulfanylpyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(3-methoxy-3-oxopropyl)sulfanylpyridine-2-carboxylic acid?
The IUPAC name of 6-(3-methoxy-3-oxopropyl)sulfanylpyridine-2-carboxylic acid (CID 60730616) is 6-(3-methoxy-3-oxopropyl)sulfanylpyridine-2-carboxylic acid.
What is the SMILES notation for 6-(3-methoxy-3-oxopropyl)sulfanylpyridine-2-carboxylic acid?
The canonical SMILES for 6-(3-methoxy-3-oxopropyl)sulfanylpyridine-2-carboxylic acid is COC(=O)CCSc1cccc(C(=O)O)n1.
What is the InChIKey of 6-(3-methoxy-3-oxopropyl)sulfanylpyridine-2-carboxylic acid?
The InChIKey is ZWCINQPEGSIOQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO4S/c1-15-9(12)5-6-16-8-4-2-3-7(11-8)10(13)14/h2-4H,5-6H2,1H3,(H,13,14).
What are the key properties of 6-(3-methoxy-3-oxopropyl)sulfanylpyridine-2-carboxylic acid?
6-(3-methoxy-3-oxopropyl)sulfanylpyridine-2-carboxylic acid has a molecular weight of 241.27 g/mol, XLogP of 1.43, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-methoxy-3-oxopropyl)sulfanylpyridine-2-carboxylic acid is sourced from PubChem (CID 60730616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).