C12H12F3N3O — CID 60730693
N-[2-(2,2,2-trifluoroethoxy)ethyl]phthalazin-1-amine (PubChem CID 60730693) has the molecular formula C12H12F3N3O and a molecular weight of 271.24 g/mol. Its IUPAC name is N-[2-(2,2,2-trifluoroethoxy)ethyl]phthalazin-1-amine.
| Compound Name | N-[2-(2,2,2-trifluoroethoxy)ethyl]phthalazin-1-amine |
|---|---|
| PubChem CID | 60730693 |
| Molecular Formula | C12H12F3N3O |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | N-[2-(2,2,2-trifluoroethoxy)ethyl]phthalazin-1-amine |
| SMILES | FC(F)(F)COCCNc1nncc2ccccc12 |
| InChI | InChI=1S/C12H12F3N3O/c13-12(14,15)8-19-6-5-16-11-10-4-2-1-3-9(10)7-17-18-11/h1-4,7H,5-6,8H2,(H,16,18) |
| InChIKey | QHBFJXVBTYJELA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|