C14H22BrNO2S — CID 60732124
2-bromo-4-methyl-N-(5-methylhexan-2-yl)benzenesulfonamide (PubChem CID 60732124) has the molecular formula C14H22BrNO2S and a molecular weight of 348.31 g/mol. Its IUPAC name is 2-bromo-4-methyl-N-(5-methylhexan-2-yl)benzenesulfonamide.
| Compound Name | 2-bromo-4-methyl-N-(5-methylhexan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 60732124 |
| Molecular Formula | C14H22BrNO2S |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 2-bromo-4-methyl-N-(5-methylhexan-2-yl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(C)CCC(C)C)c(Br)c1 |
| InChI | InChI=1S/C14H22BrNO2S/c1-10(2)5-7-12(4)16-19(17,18)14-8-6-11(3)9-13(14)15/h6,8-10,12,16H,5,7H2,1-4H3 |
| InChIKey | SUQYJZPVLXGUBI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |