C14H13ClN2O2 — CID 60734553
2-chloro-N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)pyridine-3-carboxamide (PubChem CID 60734553) has the molecular formula C14H13ClN2O2 and a molecular weight of 276.72 g/mol. Its IUPAC name is 2-chloro-N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 60734553 |
| Molecular Formula | C14H13ClN2O2 |
| Molecular Weight | 276.72 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 2-chloro-N-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)pyridine-3-carboxamide |
| SMILES | O=C(NC1CCCc2occc21)c1cccnc1Cl |
| InChI | InChI=1S/C14H13ClN2O2/c15-13-10(3-2-7-16-13)14(18)17-11-4-1-5-12-9(11)6-8-19-12/h2-3,6-8,11H,1,4-5H2,(H,17,18) |
| InChIKey | XPGTWJUKKFFWOT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.72 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|