About 2-propan-2-yloxyethyl carbamimidothioate
2-propan-2-yloxyethyl carbamimidothioate (PubChem CID 60734570) has the molecular formula C6H14N2OS
and a molecular weight of 162.26 g/mol. Its IUPAC name is 2-propan-2-yloxyethyl carbamimidothioate.
Molecular Properties
| Compound Name | 2-propan-2-yloxyethyl carbamimidothioate |
| PubChem CID | 60734570 |
| Molecular Formula | C6H14N2OS |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 2-propan-2-yloxyethyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCCOC(C)C |
| InChI | InChI=1S/C6H14N2OS/c1-5(2)9-3-4-10-6(7)8/h5H,3-4H2,1-2H3,(H3,7,8) |
| InChIKey | MHSXWQLECLRKSN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-propan-2-yloxyethyl carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yloxyethyl carbamimidothioate?
The IUPAC name of 2-propan-2-yloxyethyl carbamimidothioate (CID 60734570) is 2-propan-2-yloxyethyl carbamimidothioate.
What is the SMILES notation for 2-propan-2-yloxyethyl carbamimidothioate?
The canonical SMILES for 2-propan-2-yloxyethyl carbamimidothioate is [H]/N=C(\N)SCCOC(C)C.
What is the InChIKey of 2-propan-2-yloxyethyl carbamimidothioate?
The InChIKey is MHSXWQLECLRKSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2OS/c1-5(2)9-3-4-10-6(7)8/h5H,3-4H2,1-2H3,(H3,7,8).
What are the key properties of 2-propan-2-yloxyethyl carbamimidothioate?
2-propan-2-yloxyethyl carbamimidothioate has a molecular weight of 162.26 g/mol, XLogP of 1.04, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yloxyethyl carbamimidothioate is sourced from PubChem (CID 60734570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).