About 2-(3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methylpropyl)acetamide
2-(3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methylpropyl)acetamide (PubChem CID 60735082) has the molecular formula C12H19N3O3
and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-(3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methylpropyl)acetamide.
Molecular Properties
| Compound Name | 2-(3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methylpropyl)acetamide |
| PubChem CID | 60735082 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 2-(3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methylpropyl)acetamide |
| SMILES | CCn1ccc(=O)n(CC(=O)NCC(C)C)c1=O |
| InChI | InChI=1S/C12H19N3O3/c1-4-14-6-5-11(17)15(12(14)18)8-10(16)13-7-9(2)3/h5-6,9H,4,7-8H2,1-3H3,(H,13,16) |
| InChIKey | WTVTYAFZSKVQFY-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methylpropyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methylpropyl)acetamide?
The IUPAC name of 2-(3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methylpropyl)acetamide (CID 60735082) is 2-(3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methylpropyl)acetamide.
What is the SMILES notation for 2-(3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methylpropyl)acetamide?
The canonical SMILES for 2-(3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methylpropyl)acetamide is CCn1ccc(=O)n(CC(=O)NCC(C)C)c1=O.
What is the InChIKey of 2-(3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methylpropyl)acetamide?
The InChIKey is WTVTYAFZSKVQFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O3/c1-4-14-6-5-11(17)15(12(14)18)8-10(16)13-7-9(2)3/h5-6,9H,4,7-8H2,1-3H3,(H,13,16).
What are the key properties of 2-(3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methylpropyl)acetamide?
2-(3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methylpropyl)acetamide has a molecular weight of 253.30 g/mol, XLogP of -0.20, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethyl-2,6-dioxopyrimidin-1-yl)-N-(2-methylpropyl)acetamide is sourced from PubChem (CID 60735082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).