C16H23NO2 — CID 60737583
N-cyclopentyl-3-(2,3-dimethylphenoxy)propanamide (PubChem CID 60737583) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is N-cyclopentyl-3-(2,3-dimethylphenoxy)propanamide.
| Compound Name | N-cyclopentyl-3-(2,3-dimethylphenoxy)propanamide |
|---|---|
| PubChem CID | 60737583 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N-cyclopentyl-3-(2,3-dimethylphenoxy)propanamide |
| SMILES | Cc1cccc(OCCC(=O)NC2CCCC2)c1C |
| InChI | InChI=1S/C16H23NO2/c1-12-6-5-9-15(13(12)2)19-11-10-16(18)17-14-7-3-4-8-14/h5-6,9,14H,3-4,7-8,10-11H2,1-2H3,(H,17,18) |
| InChIKey | UCCFDJPPDYPHQW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |