C12H10F7N5O — CID 607388
4-[3-(1,1,2,2,3,3,3-heptafluoropropyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]morpholine (PubChem CID 607388) has the molecular formula C12H10F7N5O and a molecular weight of 373.23 g/mol. Its IUPAC name is 4-[3-(1,1,2,2,3,3,3-heptafluoropropyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]morpholine.
| Compound Name | 4-[3-(1,1,2,2,3,3,3-heptafluoropropyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]morpholine |
|---|---|
| PubChem CID | 607388 |
| Molecular Formula | C12H10F7N5O |
| Molecular Weight | 373.23 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 4-[3-(1,1,2,2,3,3,3-heptafluoropropyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]morpholine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)c1nnc2ccc(N3CCOCC3)nn12 |
| InChI | InChI=1S/C12H10F7N5O/c13-10(14,11(15,16)12(17,18)19)9-21-20-7-1-2-8(22-24(7)9)23-3-5-25-6-4-23/h1-2H,3-6H2 |
| InChIKey | OBSMCEMJAVGBFT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 55.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|