C13H16BrNO3 — CID 60739512
ethyl 4-[(3-bromophenyl)methylamino]-4-oxobutanoate (PubChem CID 60739512) has the molecular formula C13H16BrNO3 and a molecular weight of 314.18 g/mol. Its IUPAC name is ethyl 4-[(3-bromophenyl)methylamino]-4-oxobutanoate.
| Compound Name | ethyl 4-[(3-bromophenyl)methylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 60739512 |
| Molecular Formula | C13H16BrNO3 |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | ethyl 4-[(3-bromophenyl)methylamino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)NCc1cccc(Br)c1 |
| InChI | InChI=1S/C13H16BrNO3/c1-2-18-13(17)7-6-12(16)15-9-10-4-3-5-11(14)8-10/h3-5,8H,2,6-7,9H2,1H3,(H,15,16) |
| InChIKey | GSHKBMABYRAMPI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |