About N-(4-cyclopropyl-1,3-thiazol-2-yl)-2,2-dimethylpropanamide
N-(4-cyclopropyl-1,3-thiazol-2-yl)-2,2-dimethylpropanamide (PubChem CID 60741010) has the molecular formula C11H16N2OS
and a molecular weight of 224.33 g/mol. Its IUPAC name is N-(4-cyclopropyl-1,3-thiazol-2-yl)-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-2,2-dimethylpropanamide |
| PubChem CID | 60741010 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1nc(C2CC2)cs1 |
| InChI | InChI=1S/C11H16N2OS/c1-11(2,3)9(14)13-10-12-8(6-15-10)7-4-5-7/h6-7H,4-5H2,1-3H3,(H,12,13,14) |
| InChIKey | SNSVMMXFYJPMSF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-cyclopropyl-1,3-thiazol-2-yl)-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-cyclopropyl-1,3-thiazol-2-yl)-2,2-dimethylpropanamide?
The IUPAC name of N-(4-cyclopropyl-1,3-thiazol-2-yl)-2,2-dimethylpropanamide (CID 60741010) is N-(4-cyclopropyl-1,3-thiazol-2-yl)-2,2-dimethylpropanamide.
What is the SMILES notation for N-(4-cyclopropyl-1,3-thiazol-2-yl)-2,2-dimethylpropanamide?
The canonical SMILES for N-(4-cyclopropyl-1,3-thiazol-2-yl)-2,2-dimethylpropanamide is CC(C)(C)C(=O)Nc1nc(C2CC2)cs1.
What is the InChIKey of N-(4-cyclopropyl-1,3-thiazol-2-yl)-2,2-dimethylpropanamide?
The InChIKey is SNSVMMXFYJPMSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2OS/c1-11(2,3)9(14)13-10-12-8(6-15-10)7-4-5-7/h6-7H,4-5H2,1-3H3,(H,12,13,14).
What are the key properties of N-(4-cyclopropyl-1,3-thiazol-2-yl)-2,2-dimethylpropanamide?
N-(4-cyclopropyl-1,3-thiazol-2-yl)-2,2-dimethylpropanamide has a molecular weight of 224.33 g/mol, XLogP of 3.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-cyclopropyl-1,3-thiazol-2-yl)-2,2-dimethylpropanamide is sourced from PubChem (CID 60741010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).