C18H28O4 — CID 607432
8-hydroxy-14-pentyl-1-oxacyclotetradec-5-yne-2,10-dione (PubChem CID 607432) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is 8-hydroxy-14-pentyl-1-oxacyclotetradec-5-yne-2,10-dione.
| Compound Name | 8-hydroxy-14-pentyl-1-oxacyclotetradec-5-yne-2,10-dione |
|---|---|
| PubChem CID | 607432 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 8-hydroxy-14-pentyl-1-oxacyclotetradec-5-yne-2,10-dione |
| SMILES | CCCCCC1CCCC(=O)CC(O)CC#CCCC(=O)O1 |
| InChI | InChI=1S/C18H28O4/c1-2-3-5-11-17-12-8-10-16(20)14-15(19)9-6-4-7-13-18(21)22-17/h15,17,19H,2-3,5,7-14H2,1H3 |
| InChIKey | AFGNCSIJCHTWEH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|