About 2-chloro-N,4-dimethyl-N-[(4-methylsulfanylphenyl)methyl]-1,3-thiazole-5-sulfonamide
2-chloro-N,4-dimethyl-N-[(4-methylsulfanylphenyl)methyl]-1,3-thiazole-5-sulfonamide (PubChem CID 60744551) has the molecular formula C13H15ClN2O2S3
and a molecular weight of 362.93 g/mol. Its IUPAC name is 2-chloro-N,4-dimethyl-N-[(4-methylsulfanylphenyl)methyl]-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | 2-chloro-N,4-dimethyl-N-[(4-methylsulfanylphenyl)methyl]-1,3-thiazole-5-sulfonamide |
| PubChem CID | 60744551 |
| Molecular Formula | C13H15ClN2O2S3 |
| Molecular Weight | 362.93 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | 2-chloro-N,4-dimethyl-N-[(4-methylsulfanylphenyl)methyl]-1,3-thiazole-5-sulfonamide |
| SMILES | CSc1ccc(CN(C)S(=O)(=O)c2sc(Cl)nc2C)cc1 |
| InChI | InChI=1S/C13H15ClN2O2S3/c1-9-12(20-13(14)15-9)21(17,18)16(2)8-10-4-6-11(19-3)7-5-10/h4-7H,8H2,1-3H3 |
| InChIKey | RUVIDIJOHYUSOW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.93 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-N,4-dimethyl-N-[(4-methylsulfanylphenyl)methyl]-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N,4-dimethyl-N-[(4-methylsulfanylphenyl)methyl]-1,3-thiazole-5-sulfonamide?
The IUPAC name of 2-chloro-N,4-dimethyl-N-[(4-methylsulfanylphenyl)methyl]-1,3-thiazole-5-sulfonamide (CID 60744551) is 2-chloro-N,4-dimethyl-N-[(4-methylsulfanylphenyl)methyl]-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for 2-chloro-N,4-dimethyl-N-[(4-methylsulfanylphenyl)methyl]-1,3-thiazole-5-sulfonamide?
The canonical SMILES for 2-chloro-N,4-dimethyl-N-[(4-methylsulfanylphenyl)methyl]-1,3-thiazole-5-sulfonamide is CSc1ccc(CN(C)S(=O)(=O)c2sc(Cl)nc2C)cc1.
What is the InChIKey of 2-chloro-N,4-dimethyl-N-[(4-methylsulfanylphenyl)methyl]-1,3-thiazole-5-sulfonamide?
The InChIKey is RUVIDIJOHYUSOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClN2O2S3/c1-9-12(20-13(14)15-9)21(17,18)16(2)8-10-4-6-11(19-3)7-5-10/h4-7H,8H2,1-3H3.
What are the key properties of 2-chloro-N,4-dimethyl-N-[(4-methylsulfanylphenyl)methyl]-1,3-thiazole-5-sulfonamide?
2-chloro-N,4-dimethyl-N-[(4-methylsulfanylphenyl)methyl]-1,3-thiazole-5-sulfonamide has a molecular weight of 362.93 g/mol, XLogP of 3.65, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N,4-dimethyl-N-[(4-methylsulfanylphenyl)methyl]-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 60744551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).