About 5-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-1-methylimidazole-4-sulfonamide
5-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-1-methylimidazole-4-sulfonamide (PubChem CID 60745540) has the molecular formula C10H16ClN3O4S2
and a molecular weight of 341.84 g/mol. Its IUPAC name is 5-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-1-methylimidazole-4-sulfonamide.
Molecular Properties
| Compound Name | 5-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-1-methylimidazole-4-sulfonamide |
| PubChem CID | 60745540 |
| Molecular Formula | C10H16ClN3O4S2 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 5-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-1-methylimidazole-4-sulfonamide |
| SMILES | CCN(C1CCS(=O)(=O)C1)S(=O)(=O)c1ncn(C)c1Cl |
| InChI | InChI=1S/C10H16ClN3O4S2/c1-3-14(8-4-5-19(15,16)6-8)20(17,18)10-9(11)13(2)7-12-10/h7-8H,3-6H2,1-2H3 |
| InChIKey | YJWCYCYLWXPEFC-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 89.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-1-methylimidazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-1-methylimidazole-4-sulfonamide?
The IUPAC name of 5-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-1-methylimidazole-4-sulfonamide (CID 60745540) is 5-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-1-methylimidazole-4-sulfonamide.
What is the SMILES notation for 5-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-1-methylimidazole-4-sulfonamide?
The canonical SMILES for 5-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-1-methylimidazole-4-sulfonamide is CCN(C1CCS(=O)(=O)C1)S(=O)(=O)c1ncn(C)c1Cl.
What is the InChIKey of 5-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-1-methylimidazole-4-sulfonamide?
The InChIKey is YJWCYCYLWXPEFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16ClN3O4S2/c1-3-14(8-4-5-19(15,16)6-8)20(17,18)10-9(11)13(2)7-12-10/h7-8H,3-6H2,1-2H3.
What are the key properties of 5-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-1-methylimidazole-4-sulfonamide?
5-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-1-methylimidazole-4-sulfonamide has a molecular weight of 341.84 g/mol, XLogP of 0.27, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-(1,1-dioxothiolan-3-yl)-N-ethyl-1-methylimidazole-4-sulfonamide is sourced from PubChem (CID 60745540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).