phenyl 4-(ethylcarbamoyl)piperidine-1-carboxylate

C15H20N2O3 — CID 60746156

IUPACphenyl 4-(ethylcarbamoyl)piperidine-1-carboxylate
SMILESCCNC(=O)C1CCN(C(=O)Oc2ccccc2)CC1
InChIInChI=1S/C15H20N2O3/c1-2-16-14(18)12-8-10-17(11-9-12)15(19)20-13-6-4-3-5-7-13/h3-7,12H,2,8-11H2,1H3,(H,16,18)
InChIKeyXVBQTXCVDZNWSD-UHFFFAOYSA-N
MW276.34 g/mol
LogP2.03
Rot. Bonds3

About phenyl 4-(ethylcarbamoyl)piperidine-1-carboxylate

phenyl 4-(ethylcarbamoyl)piperidine-1-carboxylate (PubChem CID 60746156) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is phenyl 4-(ethylcarbamoyl)piperidine-1-carboxylate.

Molecular Properties

Compound Namephenyl 4-(ethylcarbamoyl)piperidine-1-carboxylate
PubChem CID60746156
Molecular FormulaC15H20N2O3
Molecular Weight276.34 g/mol
Exact Mass276.15
IUPAC Namephenyl 4-(ethylcarbamoyl)piperidine-1-carboxylate
SMILESCCNC(=O)C1CCN(C(=O)Oc2ccccc2)CC1
InChIInChI=1S/C15H20N2O3/c1-2-16-14(18)12-8-10-17(11-9-12)15(19)20-13-6-4-3-5-7-13/h3-7,12H,2,8-11H2,1H3,(H,16,18)
InChIKeyXVBQTXCVDZNWSD-UHFFFAOYSA-N
XLogP2.03
TPSA58.64 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.34
LogP ≤ 52.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze phenyl 4-(ethylcarbamoyl)piperidine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of phenyl 4-(ethylcarbamoyl)piperidine-1-carboxylate?
The IUPAC name of phenyl 4-(ethylcarbamoyl)piperidine-1-carboxylate (CID 60746156) is phenyl 4-(ethylcarbamoyl)piperidine-1-carboxylate.
What is the SMILES notation for phenyl 4-(ethylcarbamoyl)piperidine-1-carboxylate?
The canonical SMILES for phenyl 4-(ethylcarbamoyl)piperidine-1-carboxylate is CCNC(=O)C1CCN(C(=O)Oc2ccccc2)CC1.
What is the InChIKey of phenyl 4-(ethylcarbamoyl)piperidine-1-carboxylate?
The InChIKey is XVBQTXCVDZNWSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O3/c1-2-16-14(18)12-8-10-17(11-9-12)15(19)20-13-6-4-3-5-7-13/h3-7,12H,2,8-11H2,1H3,(H,16,18).
What are the key properties of phenyl 4-(ethylcarbamoyl)piperidine-1-carboxylate?
phenyl 4-(ethylcarbamoyl)piperidine-1-carboxylate has a molecular weight of 276.34 g/mol, XLogP of 2.03, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 4-(ethylcarbamoyl)piperidine-1-carboxylate is sourced from PubChem (CID 60746156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).