About 5-bromo-1-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridin-2-one
5-bromo-1-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridin-2-one (PubChem CID 60746622) has the molecular formula C10H9BrN2OS
and a molecular weight of 285.17 g/mol. Its IUPAC name is 5-bromo-1-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridin-2-one.
Molecular Properties
| Compound Name | 5-bromo-1-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridin-2-one |
| PubChem CID | 60746622 |
| Molecular Formula | C10H9BrN2OS |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 283.96 |
| IUPAC Name | 5-bromo-1-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridin-2-one |
| SMILES | Cc1nc(Cn2cc(Br)ccc2=O)cs1 |
| InChI | InChI=1S/C10H9BrN2OS/c1-7-12-9(6-15-7)5-13-4-8(11)2-3-10(13)14/h2-4,6H,5H2,1H3 |
| InChIKey | NXXNXSPSHYZSCZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-1-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridin-2-one?
The IUPAC name of 5-bromo-1-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridin-2-one (CID 60746622) is 5-bromo-1-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridin-2-one.
What is the SMILES notation for 5-bromo-1-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridin-2-one?
The canonical SMILES for 5-bromo-1-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridin-2-one is Cc1nc(Cn2cc(Br)ccc2=O)cs1.
What is the InChIKey of 5-bromo-1-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridin-2-one?
The InChIKey is NXXNXSPSHYZSCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrN2OS/c1-7-12-9(6-15-7)5-13-4-8(11)2-3-10(13)14/h2-4,6H,5H2,1H3.
What are the key properties of 5-bromo-1-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridin-2-one?
5-bromo-1-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridin-2-one has a molecular weight of 285.17 g/mol, XLogP of 2.42, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-[(2-methyl-1,3-thiazol-4-yl)methyl]pyridin-2-one is sourced from PubChem (CID 60746622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).