C9H11ClN2O2 — CID 60747484
2-chloro-N-(1-hydroxypropan-2-yl)pyridine-4-carboxamide (PubChem CID 60747484) has the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. Its IUPAC name is 2-chloro-N-(1-hydroxypropan-2-yl)pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-(1-hydroxypropan-2-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 60747484 |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 2-chloro-N-(1-hydroxypropan-2-yl)pyridine-4-carboxamide |
| SMILES | CC(CO)NC(=O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C9H11ClN2O2/c1-6(5-13)12-9(14)7-2-3-11-8(10)4-7/h2-4,6,13H,5H2,1H3,(H,12,14) |
| InChIKey | UBDCPQRYOQQBMJ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|