About 2,2-diethoxy-N'-hydroxyethanimidamide
2,2-diethoxy-N'-hydroxyethanimidamide (PubChem CID 6075407) has the molecular formula C6H14N2O3
and a molecular weight of 162.19 g/mol. Its IUPAC name is 2,2-diethoxy-N'-hydroxyethanimidamide.
Molecular Properties
| Compound Name | 2,2-diethoxy-N'-hydroxyethanimidamide |
| PubChem CID | 6075407 |
| Molecular Formula | C6H14N2O3 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 2,2-diethoxy-N'-hydroxyethanimidamide |
| SMILES | CCOC(OCC)/C(N)=N\O |
| InChI | InChI=1S/C6H14N2O3/c1-3-10-6(11-4-2)5(7)8-9/h6,9H,3-4H2,1-2H3,(H2,7,8) |
| InChIKey | JHBUYPKAJTULGX-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diethoxy-N'-hydroxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethoxy-N'-hydroxyethanimidamide?
The IUPAC name of 2,2-diethoxy-N'-hydroxyethanimidamide (CID 6075407) is 2,2-diethoxy-N'-hydroxyethanimidamide.
What is the SMILES notation for 2,2-diethoxy-N'-hydroxyethanimidamide?
The canonical SMILES for 2,2-diethoxy-N'-hydroxyethanimidamide is CCOC(OCC)/C(N)=N\O.
What is the InChIKey of 2,2-diethoxy-N'-hydroxyethanimidamide?
The InChIKey is JHBUYPKAJTULGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O3/c1-3-10-6(11-4-2)5(7)8-9/h6,9H,3-4H2,1-2H3,(H2,7,8).
What are the key properties of 2,2-diethoxy-N'-hydroxyethanimidamide?
2,2-diethoxy-N'-hydroxyethanimidamide has a molecular weight of 162.19 g/mol, XLogP of 0.13, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethoxy-N'-hydroxyethanimidamide is sourced from PubChem (CID 6075407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).