C15H18N2O4 — CID 60754710
4-[[methyl-(1-methyl-5-oxopyrrolidine-3-carbonyl)amino]methyl]benzoic acid (PubChem CID 60754710) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 4-[[methyl-(1-methyl-5-oxopyrrolidine-3-carbonyl)amino]methyl]benzoic acid.
| Compound Name | 4-[[methyl-(1-methyl-5-oxopyrrolidine-3-carbonyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 60754710 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 4-[[methyl-(1-methyl-5-oxopyrrolidine-3-carbonyl)amino]methyl]benzoic acid |
| SMILES | CN1CC(C(=O)N(C)Cc2ccc(C(=O)O)cc2)CC1=O |
| InChI | InChI=1S/C15H18N2O4/c1-16-9-12(7-13(16)18)14(19)17(2)8-10-3-5-11(6-4-10)15(20)21/h3-6,12H,7-9H2,1-2H3,(H,20,21) |
| InChIKey | HKLVUOPATXSBBH-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |