C15H22N2O — CID 60755428
N-[3-(pyrrolidin-1-ylmethyl)phenyl]butanamide (PubChem CID 60755428) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is N-[3-(pyrrolidin-1-ylmethyl)phenyl]butanamide.
| Compound Name | N-[3-(pyrrolidin-1-ylmethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 60755428 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | N-[3-(pyrrolidin-1-ylmethyl)phenyl]butanamide |
| SMILES | CCCC(=O)Nc1cccc(CN2CCCC2)c1 |
| InChI | InChI=1S/C15H22N2O/c1-2-6-15(18)16-14-8-5-7-13(11-14)12-17-9-3-4-10-17/h5,7-8,11H,2-4,6,9-10,12H2,1H3,(H,16,18) |
| InChIKey | KMYXOZKNKQLLEX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |