About N-phenylmethoxy-1,4-dioxane-2-carboxamide
N-phenylmethoxy-1,4-dioxane-2-carboxamide (PubChem CID 60756176) has the molecular formula C12H15NO4
and a molecular weight of 237.25 g/mol. Its IUPAC name is N-phenylmethoxy-1,4-dioxane-2-carboxamide.
Molecular Properties
| Compound Name | N-phenylmethoxy-1,4-dioxane-2-carboxamide |
| PubChem CID | 60756176 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | N-phenylmethoxy-1,4-dioxane-2-carboxamide |
| SMILES | O=C(NOCc1ccccc1)C1COCCO1 |
| InChI | InChI=1S/C12H15NO4/c14-12(11-9-15-6-7-16-11)13-17-8-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,13,14) |
| InChIKey | QQTFKZVAOUCGKI-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-phenylmethoxy-1,4-dioxane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenylmethoxy-1,4-dioxane-2-carboxamide?
The IUPAC name of N-phenylmethoxy-1,4-dioxane-2-carboxamide (CID 60756176) is N-phenylmethoxy-1,4-dioxane-2-carboxamide.
What is the SMILES notation for N-phenylmethoxy-1,4-dioxane-2-carboxamide?
The canonical SMILES for N-phenylmethoxy-1,4-dioxane-2-carboxamide is O=C(NOCc1ccccc1)C1COCCO1.
What is the InChIKey of N-phenylmethoxy-1,4-dioxane-2-carboxamide?
The InChIKey is QQTFKZVAOUCGKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO4/c14-12(11-9-15-6-7-16-11)13-17-8-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,13,14).
What are the key properties of N-phenylmethoxy-1,4-dioxane-2-carboxamide?
N-phenylmethoxy-1,4-dioxane-2-carboxamide has a molecular weight of 237.25 g/mol, XLogP of 0.65, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenylmethoxy-1,4-dioxane-2-carboxamide is sourced from PubChem (CID 60756176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).