About N-prop-2-enyl-1,4-dioxane-2-carboxamide
N-prop-2-enyl-1,4-dioxane-2-carboxamide (PubChem CID 60756202) has the molecular formula C8H13NO3
and a molecular weight of 171.20 g/mol. Its IUPAC name is N-prop-2-enyl-1,4-dioxane-2-carboxamide.
Molecular Properties
| Compound Name | N-prop-2-enyl-1,4-dioxane-2-carboxamide |
| PubChem CID | 60756202 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | N-prop-2-enyl-1,4-dioxane-2-carboxamide |
| SMILES | C=CCNC(=O)C1COCCO1 |
| InChI | InChI=1S/C8H13NO3/c1-2-3-9-8(10)7-6-11-4-5-12-7/h2,7H,1,3-6H2,(H,9,10) |
| InChIKey | JGLNONZDKLEHPB-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-prop-2-enyl-1,4-dioxane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-prop-2-enyl-1,4-dioxane-2-carboxamide?
The IUPAC name of N-prop-2-enyl-1,4-dioxane-2-carboxamide (CID 60756202) is N-prop-2-enyl-1,4-dioxane-2-carboxamide.
What is the SMILES notation for N-prop-2-enyl-1,4-dioxane-2-carboxamide?
The canonical SMILES for N-prop-2-enyl-1,4-dioxane-2-carboxamide is C=CCNC(=O)C1COCCO1.
What is the InChIKey of N-prop-2-enyl-1,4-dioxane-2-carboxamide?
The InChIKey is JGLNONZDKLEHPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3/c1-2-3-9-8(10)7-6-11-4-5-12-7/h2,7H,1,3-6H2,(H,9,10).
What are the key properties of N-prop-2-enyl-1,4-dioxane-2-carboxamide?
N-prop-2-enyl-1,4-dioxane-2-carboxamide has a molecular weight of 171.20 g/mol, XLogP of -0.30, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-prop-2-enyl-1,4-dioxane-2-carboxamide is sourced from PubChem (CID 60756202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).