C30H23N3OS — CID 6076317
(14E)-14-(1H-indol-3-ylmethylidene)-11-(4-methylphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 6076317) has the molecular formula C30H23N3OS and a molecular weight of 473.60 g/mol. Its IUPAC name is (14E)-14-(1H-indol-3-ylmethylidene)-11-(4-methylphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (14E)-14-(1H-indol-3-ylmethylidene)-11-(4-methylphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 6076317 |
| Molecular Formula | C30H23N3OS |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | (14E)-14-(1H-indol-3-ylmethylidene)-11-(4-methylphenyl)-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | Cc1ccc(C2C3=C(N=c4s/c(=C/c5c[nH]c6ccccc56)c(=O)n42)c2ccccc2CC3)cc1 |
| InChI | InChI=1S/C30H23N3OS/c1-18-10-12-20(13-11-18)28-24-15-14-19-6-2-3-8-23(19)27(24)32-30-33(28)29(34)26(35-30)16-21-17-31-25-9-5-4-7-22(21)25/h2-13,16-17,28,31H,14-15H2,1H3/b26-16+ |
| InChIKey | UHHIPNYCDVXEKQ-WGOQTCKBSA-N |
| XLogP | 5.11 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |