About tributyl(phenyl)stannane
tributyl(phenyl)stannane (PubChem CID 607632) has the molecular formula C18H32Sn
and a molecular weight of 367.17 g/mol. Its IUPAC name is tributyl(phenyl)stannane.
Molecular Properties
| Compound Name | tributyl(phenyl)stannane |
| PubChem CID | 607632 |
| Molecular Formula | C18H32Sn |
| Molecular Weight | 367.17 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | tributyl(phenyl)stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccccc1 |
| InChI | InChI=1S/C6H5.3C4H9.Sn/c1-2-4-6-5-3-1;3*1-3-4-2;/h1-5H;3*1,3-4H2,2H3; |
| InChIKey | SYUVAXDZVWPKSI-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.17 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tributyl(phenyl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl(phenyl)stannane?
The IUPAC name of tributyl(phenyl)stannane (CID 607632) is tributyl(phenyl)stannane.
What is the SMILES notation for tributyl(phenyl)stannane?
The canonical SMILES for tributyl(phenyl)stannane is CCCC[Sn](CCCC)(CCCC)c1ccccc1.
What is the InChIKey of tributyl(phenyl)stannane?
The InChIKey is SYUVAXDZVWPKSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5.3C4H9.Sn/c1-2-4-6-5-3-1;3*1-3-4-2;/h1-5H;3*1,3-4H2,2H3;.
What are the key properties of tributyl(phenyl)stannane?
tributyl(phenyl)stannane has a molecular weight of 367.17 g/mol, XLogP of 5.74, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl(phenyl)stannane is sourced from PubChem (CID 607632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).