About 3-[2-(4-bromophenyl)-1,3-thiazol-4-yl]-7-hydroxychromen-2-one
3-[2-(4-bromophenyl)-1,3-thiazol-4-yl]-7-hydroxychromen-2-one (PubChem CID 6076733) has the molecular formula C18H10BrNO3S
and a molecular weight of 400.25 g/mol. Its IUPAC name is 3-[2-(4-bromophenyl)-1,3-thiazol-4-yl]-7-hydroxychromen-2-one.
Molecular Properties
| Compound Name | 3-[2-(4-bromophenyl)-1,3-thiazol-4-yl]-7-hydroxychromen-2-one |
| PubChem CID | 6076733 |
| Molecular Formula | C18H10BrNO3S |
| Molecular Weight | 400.25 g/mol |
| Exact Mass | 398.96 |
| IUPAC Name | 3-[2-(4-bromophenyl)-1,3-thiazol-4-yl]-7-hydroxychromen-2-one |
| SMILES | O=c1oc2cc(O)ccc2cc1-c1csc(-c2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C18H10BrNO3S/c19-12-4-1-10(2-5-12)17-20-15(9-24-17)14-7-11-3-6-13(21)8-16(11)23-18(14)22/h1-9,21H |
| InChIKey | ORIBHDJQYRCCLY-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.25 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(4-bromophenyl)-1,3-thiazol-4-yl]-7-hydroxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(4-bromophenyl)-1,3-thiazol-4-yl]-7-hydroxychromen-2-one?
The IUPAC name of 3-[2-(4-bromophenyl)-1,3-thiazol-4-yl]-7-hydroxychromen-2-one (CID 6076733) is 3-[2-(4-bromophenyl)-1,3-thiazol-4-yl]-7-hydroxychromen-2-one.
What is the SMILES notation for 3-[2-(4-bromophenyl)-1,3-thiazol-4-yl]-7-hydroxychromen-2-one?
The canonical SMILES for 3-[2-(4-bromophenyl)-1,3-thiazol-4-yl]-7-hydroxychromen-2-one is O=c1oc2cc(O)ccc2cc1-c1csc(-c2ccc(Br)cc2)n1.
What is the InChIKey of 3-[2-(4-bromophenyl)-1,3-thiazol-4-yl]-7-hydroxychromen-2-one?
The InChIKey is ORIBHDJQYRCCLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10BrNO3S/c19-12-4-1-10(2-5-12)17-20-15(9-24-17)14-7-11-3-6-13(21)8-16(11)23-18(14)22/h1-9,21H.
What are the key properties of 3-[2-(4-bromophenyl)-1,3-thiazol-4-yl]-7-hydroxychromen-2-one?
3-[2-(4-bromophenyl)-1,3-thiazol-4-yl]-7-hydroxychromen-2-one has a molecular weight of 400.25 g/mol, XLogP of 5.05, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(4-bromophenyl)-1,3-thiazol-4-yl]-7-hydroxychromen-2-one is sourced from PubChem (CID 6076733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).