C14H20F3NO — CID 6076988
(E)-1,1,1-trifluoro-4-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)but-3-en-2-one (PubChem CID 6076988) has the molecular formula C14H20F3NO and a molecular weight of 275.31 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-4-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)but-3-en-2-one.
| Compound Name | (E)-1,1,1-trifluoro-4-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 6076988 |
| Molecular Formula | C14H20F3NO |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (E)-1,1,1-trifluoro-4-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)but-3-en-2-one |
| SMILES | CC1(C)CC2CC(C)(CN2/C=C/C(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C14H20F3NO/c1-12(2)6-10-7-13(3,8-12)9-18(10)5-4-11(19)14(15,16)17/h4-5,10H,6-9H2,1-3H3/b5-4+ |
| InChIKey | DJMYMRCPFDGRIE-SNAWJCMRSA-N |
| XLogP | 3.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|