C32H29ClN2O6 — CID 6077288
[4-[(Z)-[[2-[(4-chlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-propoxybenzoate (PubChem CID 6077288) has the molecular formula C32H29ClN2O6 and a molecular weight of 573.05 g/mol. Its IUPAC name is [4-[(Z)-[[2-[(4-chlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-propoxybenzoate.
| Compound Name | [4-[(Z)-[[2-[(4-chlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-propoxybenzoate |
|---|---|
| PubChem CID | 6077288 |
| Molecular Formula | C32H29ClN2O6 |
| Molecular Weight | 573.05 g/mol |
| Exact Mass | 572.17 |
| IUPAC Name | [4-[(Z)-[[2-[(4-chlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]-2-methoxyphenyl] 4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)Oc2ccc(/C=N\NC(=O)c3ccccc3OCc3ccc(Cl)cc3)cc2OC)cc1 |
| InChI | InChI=1S/C32H29ClN2O6/c1-3-18-39-26-15-11-24(12-16-26)32(37)41-29-17-10-23(19-30(29)38-2)20-34-35-31(36)27-6-4-5-7-28(27)40-21-22-8-13-25(33)14-9-22/h4-17,19-20H,3,18,21H2,1-2H3,(H,35,36)/b34-20- |
| InChIKey | BBMRBLKIBDKCTD-GXBUFBABSA-N |
| XLogP | 6.70 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.05 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|