C13H14N2O4 — CID 60772891
3-[2-(2-methoxy-4-methylphenyl)-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 60772891) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is 3-[2-(2-methoxy-4-methylphenyl)-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 3-[2-(2-methoxy-4-methylphenyl)-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 60772891 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 3-[2-(2-methoxy-4-methylphenyl)-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | COc1cc(C)ccc1C(=O)CN1C(=O)CNC1=O |
| InChI | InChI=1S/C13H14N2O4/c1-8-3-4-9(11(5-8)19-2)10(16)7-15-12(17)6-14-13(15)18/h3-5H,6-7H2,1-2H3,(H,14,18) |
| InChIKey | YGKAKXOJZLSCTG-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|