About 3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2-methylpropanoic acid
3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2-methylpropanoic acid (PubChem CID 60773691) has the molecular formula C10H14N2O3
and a molecular weight of 210.23 g/mol. Its IUPAC name is 3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2-methylpropanoic acid.
Analyze 3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2-methylpropanoic acid?
The IUPAC name of 3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2-methylpropanoic acid (CID 60773691) is 3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2-methylpropanoic acid.
What is the SMILES notation for 3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2-methylpropanoic acid?
The canonical SMILES for 3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2-methylpropanoic acid is Cc1cc(C)n(CC(C)C(=O)O)c(=O)n1.
What is the InChIKey of 3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2-methylpropanoic acid?
The InChIKey is YTYXHDWLORCDQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O3/c1-6(9(13)14)5-12-8(3)4-7(2)11-10(12)15/h4,6H,5H2,1-3H3,(H,13,14).
What are the key properties of 3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2-methylpropanoic acid?
3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2-methylpropanoic acid has a molecular weight of 210.23 g/mol, XLogP of 0.58, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,6-dimethyl-2-oxopyrimidin-1-yl)-2-methylpropanoic acid is sourced from PubChem (CID 60773691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).