About 2-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-5-amine
2-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-5-amine (PubChem CID 607752) has the molecular formula C6H6N4S2
and a molecular weight of 198.28 g/mol. Its IUPAC name is 2-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-5-amine.
Molecular Properties
| Compound Name | 2-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-5-amine |
| PubChem CID | 607752 |
| Molecular Formula | C6H6N4S2 |
| Molecular Weight | 198.28 g/mol |
| Exact Mass | 198.00 |
| IUPAC Name | 2-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-5-amine |
| SMILES | CSc1nc2cnc(N)nc2s1 |
| InChI | InChI=1S/C6H6N4S2/c1-11-6-9-3-2-8-5(7)10-4(3)12-6/h2H,1H3,(H2,7,8,10) |
| InChIKey | AUXBHVTXXUIPHQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-5-amine?
The IUPAC name of 2-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-5-amine (CID 607752) is 2-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-5-amine.
What is the SMILES notation for 2-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-5-amine?
The canonical SMILES for 2-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-5-amine is CSc1nc2cnc(N)nc2s1.
What is the InChIKey of 2-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-5-amine?
The InChIKey is AUXBHVTXXUIPHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4S2/c1-11-6-9-3-2-8-5(7)10-4(3)12-6/h2H,1H3,(H2,7,8,10).
What are the key properties of 2-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-5-amine?
2-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-5-amine has a molecular weight of 198.28 g/mol, XLogP of 1.39, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidin-5-amine is sourced from PubChem (CID 607752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).