C13H14N2S — CID 607760
2-phenyl-5,6,7,8-tetrahydro-1,2,3-benzothiadiazine (PubChem CID 607760) has the molecular formula C13H14N2S and a molecular weight of 230.34 g/mol. Its IUPAC name is 2-phenyl-5,6,7,8-tetrahydro-1,2,3-benzothiadiazine.
| Compound Name | 2-phenyl-5,6,7,8-tetrahydro-1,2,3-benzothiadiazine |
|---|---|
| PubChem CID | 607760 |
| Molecular Formula | C13H14N2S |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2-phenyl-5,6,7,8-tetrahydro-1,2,3-benzothiadiazine |
| SMILES | C1=NN(c2ccccc2)SC2=C1CCCC2 |
| InChI | InChI=1S/C13H14N2S/c1-2-7-12(8-3-1)15-14-10-11-6-4-5-9-13(11)16-15/h1-3,7-8,10H,4-6,9H2 |
| InChIKey | CCISSUGCYYYLST-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|