C15H21BrN2O3 — CID 60776178
3-bromo-4-methoxy-N-[4-methyl-1-(methylamino)-1-oxopentan-2-yl]benzamide (PubChem CID 60776178) has the molecular formula C15H21BrN2O3 and a molecular weight of 357.25 g/mol. Its IUPAC name is 3-bromo-4-methoxy-N-[4-methyl-1-(methylamino)-1-oxopentan-2-yl]benzamide.
| Compound Name | 3-bromo-4-methoxy-N-[4-methyl-1-(methylamino)-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 60776178 |
| Molecular Formula | C15H21BrN2O3 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 3-bromo-4-methoxy-N-[4-methyl-1-(methylamino)-1-oxopentan-2-yl]benzamide |
| SMILES | CNC(=O)C(CC(C)C)NC(=O)c1ccc(OC)c(Br)c1 |
| InChI | InChI=1S/C15H21BrN2O3/c1-9(2)7-12(15(20)17-3)18-14(19)10-5-6-13(21-4)11(16)8-10/h5-6,8-9,12H,7H2,1-4H3,(H,17,20)(H,18,19) |
| InChIKey | BYOBDQVOPWGOQZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |