C12H15F3N2O2 — CID 60778350
N-butyl-6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-carboxamide (PubChem CID 60778350) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is N-butyl-6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-carboxamide.
| Compound Name | N-butyl-6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 60778350 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | N-butyl-6-oxo-N-(2,2,2-trifluoroethyl)-1H-pyridine-3-carboxamide |
| SMILES | CCCCN(CC(F)(F)F)C(=O)c1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C12H15F3N2O2/c1-2-3-6-17(8-12(13,14)15)11(19)9-4-5-10(18)16-7-9/h4-5,7H,2-3,6,8H2,1H3,(H,16,18) |
| InChIKey | CKJRGOZHTLRVBU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |