About 2-ethoxy-N-propyl-N-(2,2,2-trifluoroethyl)acetamide
2-ethoxy-N-propyl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 60778374) has the molecular formula C9H16F3NO2
and a molecular weight of 227.23 g/mol. Its IUPAC name is 2-ethoxy-N-propyl-N-(2,2,2-trifluoroethyl)acetamide.
Molecular Properties
| Compound Name | 2-ethoxy-N-propyl-N-(2,2,2-trifluoroethyl)acetamide |
| PubChem CID | 60778374 |
| Molecular Formula | C9H16F3NO2 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 2-ethoxy-N-propyl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CCCN(CC(F)(F)F)C(=O)COCC |
| InChI | InChI=1S/C9H16F3NO2/c1-3-5-13(7-9(10,11)12)8(14)6-15-4-2/h3-7H2,1-2H3 |
| InChIKey | BRWIHOPEMRRHTC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethoxy-N-propyl-N-(2,2,2-trifluoroethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-N-propyl-N-(2,2,2-trifluoroethyl)acetamide?
The IUPAC name of 2-ethoxy-N-propyl-N-(2,2,2-trifluoroethyl)acetamide (CID 60778374) is 2-ethoxy-N-propyl-N-(2,2,2-trifluoroethyl)acetamide.
What is the SMILES notation for 2-ethoxy-N-propyl-N-(2,2,2-trifluoroethyl)acetamide?
The canonical SMILES for 2-ethoxy-N-propyl-N-(2,2,2-trifluoroethyl)acetamide is CCCN(CC(F)(F)F)C(=O)COCC.
What is the InChIKey of 2-ethoxy-N-propyl-N-(2,2,2-trifluoroethyl)acetamide?
The InChIKey is BRWIHOPEMRRHTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO2/c1-3-5-13(7-9(10,11)12)8(14)6-15-4-2/h3-7H2,1-2H3.
What are the key properties of 2-ethoxy-N-propyl-N-(2,2,2-trifluoroethyl)acetamide?
2-ethoxy-N-propyl-N-(2,2,2-trifluoroethyl)acetamide has a molecular weight of 227.23 g/mol, XLogP of 1.82, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-N-propyl-N-(2,2,2-trifluoroethyl)acetamide is sourced from PubChem (CID 60778374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).