About N-butyl-2-ethoxy-N-(2,2,2-trifluoroethyl)acetamide
N-butyl-2-ethoxy-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 60778390) has the molecular formula C10H18F3NO2
and a molecular weight of 241.25 g/mol. Its IUPAC name is N-butyl-2-ethoxy-N-(2,2,2-trifluoroethyl)acetamide.
Molecular Properties
| Compound Name | N-butyl-2-ethoxy-N-(2,2,2-trifluoroethyl)acetamide |
| PubChem CID | 60778390 |
| Molecular Formula | C10H18F3NO2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | N-butyl-2-ethoxy-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CCCCN(CC(F)(F)F)C(=O)COCC |
| InChI | InChI=1S/C10H18F3NO2/c1-3-5-6-14(8-10(11,12)13)9(15)7-16-4-2/h3-8H2,1-2H3 |
| InChIKey | GLHAZADFNHEKKP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-butyl-2-ethoxy-N-(2,2,2-trifluoroethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2-ethoxy-N-(2,2,2-trifluoroethyl)acetamide?
The IUPAC name of N-butyl-2-ethoxy-N-(2,2,2-trifluoroethyl)acetamide (CID 60778390) is N-butyl-2-ethoxy-N-(2,2,2-trifluoroethyl)acetamide.
What is the SMILES notation for N-butyl-2-ethoxy-N-(2,2,2-trifluoroethyl)acetamide?
The canonical SMILES for N-butyl-2-ethoxy-N-(2,2,2-trifluoroethyl)acetamide is CCCCN(CC(F)(F)F)C(=O)COCC.
What is the InChIKey of N-butyl-2-ethoxy-N-(2,2,2-trifluoroethyl)acetamide?
The InChIKey is GLHAZADFNHEKKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F3NO2/c1-3-5-6-14(8-10(11,12)13)9(15)7-16-4-2/h3-8H2,1-2H3.
What are the key properties of N-butyl-2-ethoxy-N-(2,2,2-trifluoroethyl)acetamide?
N-butyl-2-ethoxy-N-(2,2,2-trifluoroethyl)acetamide has a molecular weight of 241.25 g/mol, XLogP of 2.21, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2-ethoxy-N-(2,2,2-trifluoroethyl)acetamide is sourced from PubChem (CID 60778390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).